Products 58262-07-0
CAS 58262-07-0 appears in our catalog under these names: 2,5-Dimethoxy-d6-4-methyl-benzaldehyde, 2,5-Dimethoxy-4-methylbenzaldehyde-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 50 mg, 100 mg, 10 mg, 25 mg.
4-methyl-2,5-bis(trideuteriomethoxy)benzaldehyde (CAS 58262-07-0) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 186.24 g/mol. IUPAC name: 4-methyl-2,5-bis(trideuteriomethoxy)benzaldehyde. InChIKey: LRSRTWLEJBIAIT-XERRXZQWSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 186.24 g/mol |
| IUPAC name | 4-methyl-2,5-bis(trideuteriomethoxy)benzaldehyde |
| InChIKey | LRSRTWLEJBIAIT-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1C)OC([2H])([2H])[2H])C=O |
Computed by PubChem (NCBI)