CAS 58274-32-1 is the registry number for ((CHLOROMETHYL)PHENYLETHYL)TRICHLOROSILANE. Offered by: GLPBio. Available pack sizes: 100g, 25g.
Trichloro-[2-[2-(chloromethyl)phenyl]ethyl]silane (CAS 58274-32-1) is a chemical compound with the molecular formula C9H10Cl4Si and a molecular weight of 288.1 g/mol. IUPAC name: trichloro-[2-[2-(chloromethyl)phenyl]ethyl]silane. InChIKey: FXSLEABRPLKKBE-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl4Si |
|---|---|
| Molecular weight | 288.1 g/mol |
| IUPAC name | trichloro-[2-[2-(chloromethyl)phenyl]ethyl]silane |
| InChIKey | FXSLEABRPLKKBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC[Si](Cl)(Cl)Cl)CCl |
Computed by PubChem (NCBI)