CAS 5831-43-6 appears in our catalog under these names: 1,1,2,2–Tetra–p–tolylethene, 1,1,2,2-Tetra-p-tolylethene, 99%, 99%, 1,1,2,2-Tetra-p-tolylethene, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
1-methyl-4-[1,2,2-tris(4-methylphenyl)ethenyl]benzene (CAS 5831-43-6) is a chemical compound with the molecular formula C30H28 and a molecular weight of 388.5 g/mol. IUPAC name: 1-methyl-4-[1,2,2-tris(4-methylphenyl)ethenyl]benzene. InChIKey: KNBCWMJBIJTDTC-UHFFFAOYSA-N.
| Molecular formula | C30H28 |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | 1-methyl-4-[1,2,2-tris(4-methylphenyl)ethenyl]benzene |
| InChIKey | KNBCWMJBIJTDTC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C)C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)