Products 5832-44-0

CAS 5832-44-0 is the registry number for 4-Methyl-3-nitropyridine, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 500g.

Structural formula: {0} (CAS {1})

4-methyl-3-nitropyridine (CAS 5832-44-0) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 4-methyl-3-nitropyridine. InChIKey: JLNRJMGYBKMDGI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N2O2
Molecular weight138.12 g/mol
IUPAC name4-methyl-3-nitropyridine
InChIKeyJLNRJMGYBKMDGI-UHFFFAOYSA-N
SMILESCC1=C(C=NC=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)