CAS 5832-44-0 is the registry number for 4-Methyl-3-nitropyridine, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 500g.
4-methyl-3-nitropyridine (CAS 5832-44-0) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 4-methyl-3-nitropyridine. InChIKey: JLNRJMGYBKMDGI-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | 4-methyl-3-nitropyridine |
| InChIKey | JLNRJMGYBKMDGI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)