CAS 58344-73-3 is the registry number for Stiripentol Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one (CAS 58344-73-3) is a chemical compound with the molecular formula C14H15ClO3 and a molecular weight of 266.72 g/mol. IUPAC name: (E)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one. InChIKey: RMQRHQHIHVYGTO-SNAWJCMRSA-N.
| Molecular formula | C14H15ClO3 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | (E)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one |
| InChIKey | RMQRHQHIHVYGTO-SNAWJCMRSA-N |
| SMILES | CC(C)(C)C(=O)/C=C/C1=CC2=C(C=C1Cl)OCO2 |
Computed by PubChem (NCBI)