Products 58380-92-0
CAS 58380-92-0 is the registry number for 3,3,4,5,5,5-Hexafluoro-2-methyl-pentan-2-ol, 97%. Offered by: Fluorochem. Available pack sizes: 250mg.
3,3,4,5,5,5-hexafluoro-2-methylpentan-2-ol (CAS 58380-92-0) is a chemical compound with the molecular formula C6H8F6O and a molecular weight of 210.12 g/mol. IUPAC name: 3,3,4,5,5,5-hexafluoro-2-methylpentan-2-ol. InChIKey: AHOBFJZDSQJNCO-UHFFFAOYSA-N.
| Molecular formula | C6H8F6O |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 3,3,4,5,5,5-hexafluoro-2-methylpentan-2-ol |
| InChIKey | AHOBFJZDSQJNCO-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C(C(F)(F)F)F)(F)F)O |
Computed by PubChem (NCBI)