Products 58394-64-2

CAS 58394-64-2 is the registry number for Benzyl 2-Ethylhexyl Adipate. Offered by: TRC. Available pack sizes: 2,5g.

Structural formula: {0} (CAS {1})

1-O-benzyl 6-O-(2-ethylhexyl) hexanedioate (CAS 58394-64-2) is a chemical compound with the molecular formula C21H32O4 and a molecular weight of 348.5 g/mol. IUPAC name: 1-O-benzyl 6-O-(2-ethylhexyl) hexanedioate. InChIKey: OOUQSWGHJPCRLI-UHFFFAOYSA-N.

Identity
Molecular formulaC21H32O4
Molecular weight348.5 g/mol
IUPAC name1-O-benzyl 6-O-(2-ethylhexyl) hexanedioate
InChIKeyOOUQSWGHJPCRLI-UHFFFAOYSA-N
SMILESCCCCC(CC)COC(=O)CCCCC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)