CAS 58414-55-4 appears in our catalog under these names: 2-(2,5-Dichlorothiophen-3-yl)-2-oxoacetic acid, 95%, 2-(2,5-Dichlorothiophen-3-yl)-2-oxoacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(2,5-dichlorothiophen-3-yl)-2-oxoacetic acid (CAS 58414-55-4) is a chemical compound with the molecular formula C6H2Cl2O3S and a molecular weight of 225.05 g/mol. IUPAC name: 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetic acid. InChIKey: NYEQOASPWDUDFX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2O3S |
|---|---|
| Molecular weight | 225.05 g/mol |
| IUPAC name | 2-(2,5-dichlorothiophen-3-yl)-2-oxoacetic acid |
| InChIKey | NYEQOASPWDUDFX-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1C(=O)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)