CAS 58416-04-9 appears in our catalog under these names: Dimethyl 3,4–Dihydroxy–2,5–thiophenedicarboxylate, Dimethyl 3,4-Dihydroxy-2,5-thiophenedicarboxylate, >98.0%(GC), Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate 98%, Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate, 98%, 98%, Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate, 96%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 10g.
Dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate (CAS 58416-04-9) is a chemical compound with the molecular formula C8H8O6S and a molecular weight of 232.21 g/mol. IUPAC name: dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate. InChIKey: ZZVINKJCOXPIKL-UHFFFAOYSA-N.
| Molecular formula | C8H8O6S |
|---|---|
| Molecular weight | 232.21 g/mol |
| IUPAC name | dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate |
| InChIKey | ZZVINKJCOXPIKL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(S1)C(=O)OC)O)O |
Computed by PubChem (NCBI)