Products 58432-26-1
CAS 58432-26-1 appears in our catalog under these names: 4-(Bromomethyl)-1-phenyl-1H-1,2,3-triazo, le, 1 g, 4-(Bromomethyl)-1-phenyl-1H-1,2,3-triazole, 4-(Bromomethyl)-1-phenyl-1H-1,2,3-triazo, le, 100 mg, 4-(Bromomethyl)-1-phenyl-1H-1,2,3-triazo, le, 250 mg, 4-(Bromomethyl)-1-phenyl-1H-1,2,3-triazo, le, 500 mg. Offered by: Roth, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg.
4-(bromomethyl)-1-phenyltriazole (CAS 58432-26-1) is a chemical compound with the molecular formula C9H8BrN3 and a molecular weight of 238.08 g/mol. IUPAC name: 4-(bromomethyl)-1-phenyltriazole. InChIKey: ZIGZFVQFYCRRGD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3 |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 4-(bromomethyl)-1-phenyltriazole |
| InChIKey | ZIGZFVQFYCRRGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(N=N2)CBr |
Computed by PubChem (NCBI)