CAS 58436-29-6 appears in our catalog under these names: (E)-3-Hydroxy-4',5-dimethoxystilbene, 3-Hydroxy-5,4'-dimethoxystilbene, (E)-3-Hydroxy-4',5-dimethoxystilbene, ≥98%, ≥98%, 3-Hydroxy-4',5-dimethoxystilbene. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 5mg.
3-methoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenol (CAS 58436-29-6) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 3-methoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenol. InChIKey: ULMJJZHWFJYIMM-ONEGZZNKSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 3-methoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenol |
| InChIKey | ULMJJZHWFJYIMM-ONEGZZNKSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=CC(=CC(=C2)OC)O |
Computed by PubChem (NCBI)