CAS 58446-29-0 appears in our catalog under these names: Diflunisal 1-O-beta-D-Glucuronide, Diflunisal Phenolic Glucuronide Lithium Salt. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, on request.
(2S,3S,4S,5R,6S)-6-[2-carboxy-4-(2,4-difluorophenyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 58446-29-0) is a chemical compound with the molecular formula C19H16F2O9 and a molecular weight of 426.3 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[2-carboxy-4-(2,4-difluorophenyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: RBZXVQOCMCPTHC-KSPMYQCISA-N.
| Molecular formula | C19H16F2O9 |
|---|---|
| Molecular weight | 426.3 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[2-carboxy-4-(2,4-difluorophenyl)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | RBZXVQOCMCPTHC-KSPMYQCISA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=C(C=C2)F)F)C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)