CAS 58460-11-0 is the registry number for 2-tert-Butyl-1,3-benzothiazol-6-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-tert-butyl-1,3-benzothiazol-6-amine (CAS 58460-11-0) is a chemical compound with the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. IUPAC name: 2-tert-butyl-1,3-benzothiazol-6-amine. InChIKey: QKGGZKTXLRYIOP-UHFFFAOYSA-N.
| Molecular formula | C11H14N2S |
|---|---|
| Molecular weight | 206.31 g/mol |
| IUPAC name | 2-tert-butyl-1,3-benzothiazol-6-amine |
| InChIKey | QKGGZKTXLRYIOP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=C(S1)C=C(C=C2)N |
Computed by PubChem (NCBI)