Products 58480-54-9
CAS 58480-54-9 appears in our catalog under these names: Lehmannine, Lehmannine, 98.89%, 98.89%, Lehmannine, 98.28%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 2mg, 10mg, 5mg, 25mg, 50mg, 1mg, 5 mg.
(1S,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-3-en-6-one (CAS 58480-54-9) is a chemical compound with the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. IUPAC name: (1S,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-3-en-6-one. InChIKey: WUVYENIUARJBNM-JLNYLFASSA-N.
| Molecular formula | C15H22N2O |
|---|---|
| Molecular weight | 246.35 g/mol |
| IUPAC name | (1S,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-3-en-6-one |
| InChIKey | WUVYENIUARJBNM-JLNYLFASSA-N |
| SMILES | C1C[C@H]2CN3[C@H](C=CCC3=O)[C@@H]4[C@H]2N(C1)CCC4 |
Computed by PubChem (NCBI)
Synonyms:
Lehmannine, Matridin-15-one, 12,13-didehydro-, 12-Dehydromatrine, (1S,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-3-en-6-one, (1S,2R,9S,17S)-7,13-diazatetracyclo(7.7.1.02,7.013,17)heptadec-3-en-6-one, LMN cpd, Lemannine, 12,13-Didehydromatridin-15-one, Lehmanine, (+)-lehmannine