CAS 58483-49-1 is the registry number for Noradrenaline (Norepinephrine) Impurity 92. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,3-dihydroxyphenyl)-2-hydroxyethanone (CAS 58483-49-1) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. IUPAC name: 1-(2,3-dihydroxyphenyl)-2-hydroxyethanone. InChIKey: ACTPYHPBJXGSMC-UHFFFAOYSA-N.
| Molecular formula | C8H8O4 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 1-(2,3-dihydroxyphenyl)-2-hydroxyethanone |
| InChIKey | ACTPYHPBJXGSMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)C(=O)CO |
Computed by PubChem (NCBI)