CAS 58485-32-8 is the registry number for Arginine Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,6S)-3,6-bis(3-aminopropyl)piperazine-2,5-dione (CAS 58485-32-8) is a chemical compound with the molecular formula C10H20N4O2 and a molecular weight of 228.29 g/mol. IUPAC name: (3S,6S)-3,6-bis(3-aminopropyl)piperazine-2,5-dione. InChIKey: WAYVTMRVUGPGNC-YUMQZZPRSA-N.
| Molecular formula | C10H20N4O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | (3S,6S)-3,6-bis(3-aminopropyl)piperazine-2,5-dione |
| InChIKey | WAYVTMRVUGPGNC-YUMQZZPRSA-N |
| SMILES | C(C[C@H]1C(=O)N[C@H](C(=O)N1)CCCN)CN |
Computed by PubChem (NCBI)