CAS 5849-36-5 appears in our catalog under these names: Diphenylphosphinic anhydride, 98%, Diphenylphosphinic Anhydride, Diphenylphosphinic Anhydride, >98.0%(T), Diphenylphosphinic Anhydride, 98%+,RG, 98%+,RG. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 5g, 1g.
[diphenylphosphoryloxy(phenyl)phosphoryl]benzene (CAS 5849-36-5) is a chemical compound with the molecular formula C24H20O3P2 and a molecular weight of 418.4 g/mol. IUPAC name: [diphenylphosphoryloxy(phenyl)phosphoryl]benzene. InChIKey: XTAYANNRWHXQOL-UHFFFAOYSA-N.
| Molecular formula | C24H20O3P2 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | [diphenylphosphoryloxy(phenyl)phosphoryl]benzene |
| InChIKey | XTAYANNRWHXQOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)OP(=O)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)