Products 585-50-2
CAS 585-50-2 appears in our catalog under these names: 3-(3-(Trifluoromethyl)phenyl) Propanoic Acid, 3-(3-(Trifluoromethyl)phenyl)propanoic Acid, 3–(3–Trifluoromethylphenyl)propionic Acid, 3-(3-Trifluoromethylphenyl)propionic Acid, >98.0%(GC)(T), 3-(3-(Trifluoromethyl)phenyl)propanoic acid, 98%, 98%. Offered by: Chemat Brand, Mikromol, GLPBio, TCI, Chemat. Available pack sizes: on request, 100mg, 100g, 25g, 1g, 5g, 10g, 500g.
3-[3-(trifluoromethyl)phenyl]propanoic acid (CAS 585-50-2) is a chemical compound with the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]propanoic acid. InChIKey: YLTJJMIWCCJIHI-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O2 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | YLTJJMIWCCJIHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(3-(trifluoromethyl)phenyl)propanoic acid, 3-[3-(trifluoromethyl)phenyl]propanoic Acid, Cinacalcet (m5), m-(Trifluoromethyl)hydrocinnamic acid, 3-[3-(Trifluoromethyl)phenyl]propionic acid, 3-(3-trifluoromethyl-phenyl) -propionic acid, Cinacalcet Impurity 116, 3-(3-trifluoromethyl-phenyl)-propionic acid, 3-trifluoromethylbenylacetic acid, m-trifluoromethylbenzyl acetic acid