CAS 5850-86-2 appears in our catalog under these names: Acid Orange 8 (Technical Grade), C.I Acid orange 8. Offered by: TRC, MedChemExpress. Available pack sizes: 10g, 2,5g, 5g, 1 g, 100 mg, 10 g, 5 g.
Sodium 4-[(2-hydroxynaphthalen-1-yl)diazenyl]-3-methylbenzenesulfonate (CAS 5850-86-2) is a chemical compound with the molecular formula C17H13N2NaO4S and a molecular weight of 364.4 g/mol. IUPAC name: sodium 4-[(2-hydroxynaphthalen-1-yl)diazenyl]-3-methylbenzenesulfonate. InChIKey: WPWNIQBSYQVEKJ-UHFFFAOYSA-M.
| Molecular formula | C17H13N2NaO4S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | sodium 4-[(2-hydroxynaphthalen-1-yl)diazenyl]-3-methylbenzenesulfonate |
| InChIKey | WPWNIQBSYQVEKJ-UHFFFAOYSA-M |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)[O-])N=NC2=C(C=CC3=CC=CC=C32)O.[Na+] |
Computed by PubChem (NCBI)