Products 58506-24-4
CAS 58506-24-4 appears in our catalog under these names: (2-Methoxy-5-methylphenyl)acetic acid, 95%, 2-Methoxy-5-methylphenylacetic acid, 2-Methoxy-5-methylphenylacetic acid, >95%, >95%, 2-Methoxy-5-methylphenylacetic acid, >95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2,5g, 25g.
2-(2-methoxy-5-methylphenyl)acetic acid (CAS 58506-24-4) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(2-methoxy-5-methylphenyl)acetic acid. InChIKey: GHVGGBAEPWMNGB-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 2-(2-methoxy-5-methylphenyl)acetic acid |
| InChIKey | GHVGGBAEPWMNGB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)CC(=O)O |
Computed by PubChem (NCBI)