Products 5854-11-5
CAS 5854-11-5 is the registry number for CB 3705. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[(2-amino-4-oxo-3H-quinazolin-6-yl)methylamino]benzoyl]amino]pentanedioic acid (CAS 5854-11-5) is a chemical compound with the molecular formula C21H21N5O6 and a molecular weight of 439.4 g/mol. IUPAC name: (2S)-2-[[4-[(2-amino-4-oxo-3H-quinazolin-6-yl)methylamino]benzoyl]amino]pentanedioic acid. InChIKey: UQFCLENKCDVITL-INIZCTEOSA-N.
| Molecular formula | C21H21N5O6 |
|---|---|
| Molecular weight | 439.4 g/mol |
| IUPAC name | (2S)-2-[[4-[(2-amino-4-oxo-3H-quinazolin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
| InChIKey | UQFCLENKCDVITL-INIZCTEOSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC2=CC3=C(C=C2)N=C(NC3=O)N |
Computed by PubChem (NCBI)