CAS 5854-77-3 appears in our catalog under these names: (2S,3R)-tert-Butyl 2-amino-3-(tert-butoxy)butanoate acetate, 95%, H-L-Thr(tBu)-OtBu*AcOH, O-tert-Butyl-L-threonine tert-butyl ester acetate, H-Thr(tBu)-OtBu·AcOH 98%, O-tert-Butyl-L-threonine tert-butyl ester acetate salt, 98%, 98%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 100g, 10g, 5g, 0,01kg, 0,025kg, 0,05kg.
Acetic acid;tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate (CAS 5854-77-3) is a chemical compound with the molecular formula C14H29NO5 and a molecular weight of 291.38 g/mol. IUPAC name: acetic acid;tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate. InChIKey: BGAUVMFJRASONL-RJUBDTSPSA-N.
| Molecular formula | C14H29NO5 |
|---|---|
| Molecular weight | 291.38 g/mol |
| IUPAC name | acetic acid;tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate |
| InChIKey | BGAUVMFJRASONL-RJUBDTSPSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC(C)(C)C)N)OC(C)(C)C.CC(=O)O |
Computed by PubChem (NCBI)