Products 585532-25-8
CAS 585532-25-8 is the registry number for 4–(Trifluoromethyl)bicyclo(2·2·2)octane–1–carbonitrile. Offered by: GLPBio. Available pack sizes: 100mg, 10g, 1g, 250mg, 500mg, 5g.
4-(trifluoromethyl)bicyclo[2.2.2]octane-1-carbonitrile (CAS 585532-25-8) is a chemical compound with the molecular formula C10H12F3N and a molecular weight of 203.20 g/mol. IUPAC name: 4-(trifluoromethyl)bicyclo[2.2.2]octane-1-carbonitrile. InChIKey: VDGPMGOWHZQPEJ-UHFFFAOYSA-N.
| Molecular formula | C10H12F3N |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 4-(trifluoromethyl)bicyclo[2.2.2]octane-1-carbonitrile |
| InChIKey | VDGPMGOWHZQPEJ-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(CC2)C#N)C(F)(F)F |
Computed by PubChem (NCBI)