CAS 585570-08-7 is the registry number for N,N'-Bis(4-bromophenyl)benzidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[4-(4-bromoanilino)phenyl]-N-(4-bromophenyl)aniline (CAS 585570-08-7) is a chemical compound with the molecular formula C24H18Br2N2 and a molecular weight of 494.2 g/mol. IUPAC name: 4-[4-(4-bromoanilino)phenyl]-N-(4-bromophenyl)aniline. InChIKey: DXTBWEYORVJILO-UHFFFAOYSA-N.
| Molecular formula | C24H18Br2N2 |
|---|---|
| Molecular weight | 494.2 g/mol |
| IUPAC name | 4-[4-(4-bromoanilino)phenyl]-N-(4-bromophenyl)aniline |
| InChIKey | DXTBWEYORVJILO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)NC3=CC=C(C=C3)Br)NC4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)