CAS 5858-33-3 appears in our catalog under these names: Sodium 3-hydroxy-4-(naphthalen-1-yldiazenyl)naphthalene-2,7-disulfonate, 98%, Bordeaux Red, 2,7-Naphthalenedisulfonic acid, 3-hydroxy-4-(1-naphthalenylazo)-,disodium salt. Offered by: AmBeed, TCI, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 5 g, 10 g, 1 g.
Disodium;3-hydroxy-4-(naphthalen-1-yldiazenyl)naphthalene-2,7-disulfonate (CAS 5858-33-3) is a chemical compound with the molecular formula C20H12N2Na2O7S2 and a molecular weight of 502.4 g/mol. IUPAC name: disodium;3-hydroxy-4-(naphthalen-1-yldiazenyl)naphthalene-2,7-disulfonate. InChIKey: LHRXTFDXJQAGAV-UHFFFAOYSA-L.
| Molecular formula | C20H12N2Na2O7S2 |
|---|---|
| Molecular weight | 502.4 g/mol |
| IUPAC name | disodium;3-hydroxy-4-(naphthalen-1-yldiazenyl)naphthalene-2,7-disulfonate |
| InChIKey | LHRXTFDXJQAGAV-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N=NC3=C4C=CC(=CC4=CC(=C3O)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)