CAS 5858-51-5 appears in our catalog under these names: Acid brown 4, 95%, Acid Brown 4. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 250mg, 1g, Get quote.
Sodium 6-[(4-aminophenyl)diazenyl]-5-hydroxynaphthalene-1-sulfonate (CAS 5858-51-5) is a chemical compound with the molecular formula C16H12N3NaO4S and a molecular weight of 365.3 g/mol. IUPAC name: sodium 6-[(4-aminophenyl)diazenyl]-5-hydroxynaphthalene-1-sulfonate. InChIKey: VFYDFVDOOIPQHX-UHFFFAOYSA-M.
| Molecular formula | C16H12N3NaO4S |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | sodium 6-[(4-aminophenyl)diazenyl]-5-hydroxynaphthalene-1-sulfonate |
| InChIKey | VFYDFVDOOIPQHX-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C=CC(=C2O)N=NC3=CC=C(C=C3)N)C(=C1)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)