CAS 5858-81-1 appears in our catalog under these names: Disodium 3-Hydroxy-4-((4-methyl-2-sulfonatophenyl)diazenyl)-2-naphthoate, Pigment Red 57. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 1g, 500mg, 5g, 50g, 100g, 250g, 500g, 50 mg.
Disodium;2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-5-methylbenzenesulfonate (CAS 5858-81-1) is a chemical compound with the molecular formula C18H12N2Na2O6S and a molecular weight of 430.3 g/mol. IUPAC name: disodium;2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-5-methylbenzenesulfonate. InChIKey: VPWFPZBFBFHIIL-UHFFFAOYSA-L.
| Molecular formula | C18H12N2Na2O6S |
|---|---|
| Molecular weight | 430.3 g/mol |
| IUPAC name | disodium;2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-5-methylbenzenesulfonate |
| InChIKey | VPWFPZBFBFHIIL-UHFFFAOYSA-L |
| SMILES | CC1=CC(=C(C=C1)N=NC2=C(C(=CC3=CC=CC=C32)C(=O)O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)