CAS 58605-10-0 appears in our catalog under these names: Methyl 3,5–Dibenzyloxybenzoate, Methyl 3,5-Dibenzyloxybenzoate, >98.0%(GC), Methyl 3,5-bis(benzyloxy)benzoate 97%, Methyl 3,5-Bis(Benzyloxy)Benzoate, 97%, 97%, METHYL 3,5-DIBENZYLOXYBENZOATE, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g.
Methyl 3,5-bis(phenylmethoxy)benzoate (CAS 58605-10-0) is a chemical compound with the molecular formula C22H20O4 and a molecular weight of 348.4 g/mol. IUPAC name: methyl 3,5-bis(phenylmethoxy)benzoate. InChIKey: GBQCMRLPXFXVIN-UHFFFAOYSA-N.
| Molecular formula | C22H20O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | methyl 3,5-bis(phenylmethoxy)benzoate |
| InChIKey | GBQCMRLPXFXVIN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)OCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)