CAS 58616-97-0 appears in our catalog under these names: (1S,2S)-Cyclobutane-1,2-dicarboxylic acid, 97%, 97%, (1S,2S)-Cyclobutane-1,2-dicarboxylic acid, 98%. Offered by: Chemat, AmBeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
Trans-(1S,2S)-cyclobutane-1,2-dicarboxylic acid (CAS 58616-97-0) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: trans-(1S,2S)-cyclobutane-1,2-dicarboxylic acid. InChIKey: SUSAGCZZQKACKE-IMJSIDKUSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | trans-(1S,2S)-cyclobutane-1,2-dicarboxylic acid |
| InChIKey | SUSAGCZZQKACKE-IMJSIDKUSA-N |
| SMILES | C1C[C@@H]([C@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)