CAS 586330-18-9 appears in our catalog under these names: 3-Iodo-6-nitro-indazole-1-carboxylic acid tert-butyl ester, 95%, tert-Butyl 3-iodo-6-nitro-1H-indazole-1-carboxylate, 95+%, Tert–Butyl 3–Iodo–6–Nitro–1H–Indazole–1–Carboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 100mg.
Tert-butyl 3-iodo-6-nitroindazole-1-carboxylate (CAS 586330-18-9) is a chemical compound with the molecular formula C12H12IN3O4 and a molecular weight of 389.15 g/mol. IUPAC name: tert-butyl 3-iodo-6-nitroindazole-1-carboxylate. InChIKey: LDINLYRPDJPXTG-UHFFFAOYSA-N.
| Molecular formula | C12H12IN3O4 |
|---|---|
| Molecular weight | 389.15 g/mol |
| IUPAC name | tert-butyl 3-iodo-6-nitroindazole-1-carboxylate |
| InChIKey | LDINLYRPDJPXTG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=CC(=C2)[N+](=O)[O-])C(=N1)I |
Computed by PubChem (NCBI)