Products 586395-04-2
CAS 586395-04-2 is the registry number for MurA-IN-7. Offered by: MedChemExpress. Available pack sizes: 50 mg, 100 mg, 5 mg, 25 mg, 10 mg.
N-[3,5-bis(trifluoromethyl)phenyl]prop-2-enamide (CAS 586395-04-2) is a chemical compound with the molecular formula C11H7F6NO and a molecular weight of 283.17 g/mol. IUPAC name: N-[3,5-bis(trifluoromethyl)phenyl]prop-2-enamide. InChIKey: OQVKOZLZNWNAHC-UHFFFAOYSA-N.
| Molecular formula | C11H7F6NO |
|---|---|
| Molecular weight | 283.17 g/mol |
| IUPAC name | N-[3,5-bis(trifluoromethyl)phenyl]prop-2-enamide |
| InChIKey | OQVKOZLZNWNAHC-UHFFFAOYSA-N |
| SMILES | C=CC(=O)NC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)