CAS 58656-04-5 appears in our catalog under these names: Tricyclohexylphosphonium Tetrafluoroborate, Tricyclohexylphosphine tetrafluoroborate, Tricyclohexylphosphonium tetrafluoroborate, 99% , Tricyclohexylphosphonium Tetrafluoroborate, >98.0%(T), Tricyclohexylphosphonium tetrafluoroborate, 99%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 1g, 500mg, 5g, 100g, 500g, 10g, 25g, 50g.
Tricyclohexylphosphanium tetrafluoroborate (CAS 58656-04-5) is a chemical compound with the molecular formula C18H34BF4P and a molecular weight of 368.2 g/mol. IUPAC name: tricyclohexylphosphanium tetrafluoroborate. InChIKey: MYSMMEUXKHJYKH-UHFFFAOYSA-O.
| Molecular formula | C18H34BF4P |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | tricyclohexylphosphanium tetrafluoroborate |
| InChIKey | MYSMMEUXKHJYKH-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.C1CCC(CC1)[PH+](C2CCCCC2)C3CCCCC3 |
Computed by PubChem (NCBI)