Products 58699-61-9
CAS 58699-61-9 appears in our catalog under these names: 2'–Azido–2'–deoxyadenosine, 2'-Azido-2'-deoxyadenosine, 2'-Azido-2'-deoxyadenosine, 25 mg, 2'-Azido-2'-deoxyadenosine, 50 mg, 2'-Azido-2'-deoxyadenosine, 100 mg. Offered by: GLPBio, Biosynth, Roth, Chemat. Available pack sizes: 1mg, 5mg, 50mg, 25mg, 100mg, 500mg, 250mg, 10mg.
(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(hydroxymethyl)oxolan-3-ol (CAS 58699-61-9) is a chemical compound with the molecular formula C10H12N8O3 and a molecular weight of 292.25 g/mol. IUPAC name: (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(hydroxymethyl)oxolan-3-ol. InChIKey: IFVJLCHSLGMHEY-QYYRPYCUSA-N.
| Molecular formula | C10H12N8O3 |
|---|---|
| Molecular weight | 292.25 g/mol |
| IUPAC name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-azido-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | IFVJLCHSLGMHEY-QYYRPYCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)N=[N+]=[N-])N |
Computed by PubChem (NCBI)