Products 587-23-5
CAS 587-23-5 appears in our catalog under these names: Methenamine Mandelate, METHENAMINE MANDELATE. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 2,5g, 50mg, 10mg, 25mg, 100mg.
2-hydroxy-2-phenylacetic acid;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane (CAS 587-23-5) is a chemical compound with the molecular formula C14H20N4O3 and a molecular weight of 292.33 g/mol. IUPAC name: 2-hydroxy-2-phenylacetic acid;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane. InChIKey: UXNFIJPHRQEWRQ-UHFFFAOYSA-N.
| Molecular formula | C14H20N4O3 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 2-hydroxy-2-phenylacetic acid;1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane |
| InChIKey | UXNFIJPHRQEWRQ-UHFFFAOYSA-N |
| SMILES | C1N2CN3CN1CN(C2)C3.C1=CC=C(C=C1)C(C(=O)O)O |
Computed by PubChem (NCBI)