CAS 587-90-6 appears in our catalog under these names: Nicarbazin Impurity 1, 1,3-Bis(4-nitrophenyl)urea, >95% (HPLC), N,N'-Bis-(4-nitrophenyl)urea, N,N'-Bis-(4-nitrophenyl)urea 100 µg/mL in Acetonitrile/DMSO, 1,3-BIS(4-NITROPHENYL)UREA, 97%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich, Chemat. Available pack sizes: on request, 10g, 1g, 5g, 250mg, 1ml, 1x250mg, 25g.
1,3-bis(4-nitrophenyl)urea (CAS 587-90-6) is a chemical compound with the molecular formula C13H10N4O5 and a molecular weight of 302.24 g/mol. IUPAC name: 1,3-bis(4-nitrophenyl)urea. InChIKey: JEZZOKXIXNSKQD-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O5 |
|---|---|
| Molecular weight | 302.24 g/mol |
| IUPAC name | 1,3-bis(4-nitrophenyl)urea |
| InChIKey | JEZZOKXIXNSKQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)NC2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)