Products 58717-02-5
CAS 58717-02-5 appears in our catalog under these names: (R)-D-Cyclohexylalanine, >95% (HPLC), H–D–Cha–OH, H-D-Cha-OH, (R)-2-amino-3-cyclohexylpropanoic acid, 95%, 95%, D-3-Cyclohexylalanine, 95%. Offered by: TRC, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 250mg, 25 g, 100 g.
(2R)-2-amino-3-cyclohexylpropanoic acid (CAS 58717-02-5) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: (2R)-2-amino-3-cyclohexylpropanoic acid. InChIKey: ORQXBVXKBGUSBA-MRVPVSSYSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | (2R)-2-amino-3-cyclohexylpropanoic acid |
| InChIKey | ORQXBVXKBGUSBA-MRVPVSSYSA-N |
| SMILES | C1CCC(CC1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)