Products 58722-36-4
CAS 58722-36-4 is the registry number for 4-(2-Bromoacetyl)-N,N-diethylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(2-bromoacetyl)-N,N-diethylbenzenesulfonamide (CAS 58722-36-4) is a chemical compound with the molecular formula C12H16BrNO3S and a molecular weight of 334.23 g/mol. IUPAC name: 4-(2-bromoacetyl)-N,N-diethylbenzenesulfonamide. InChIKey: XSACATWDWOSQKU-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO3S |
|---|---|
| Molecular weight | 334.23 g/mol |
| IUPAC name | 4-(2-bromoacetyl)-N,N-diethylbenzenesulfonamide |
| InChIKey | XSACATWDWOSQKU-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)C(=O)CBr |
Computed by PubChem (NCBI)