CAS 58787-14-7 is the registry number for 1-Chloro-9h-indeno[2,1-c]pyridin-9-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-chloroindeno[2,1-c]pyridin-9-one (CAS 58787-14-7) is a chemical compound with the molecular formula C12H6ClNO and a molecular weight of 215.63 g/mol. IUPAC name: 1-chloroindeno[2,1-c]pyridin-9-one. InChIKey: RWNMCMIMSZBPPE-UHFFFAOYSA-N.
| Molecular formula | C12H6ClNO |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 1-chloroindeno[2,1-c]pyridin-9-one |
| InChIKey | RWNMCMIMSZBPPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C(=NC=C3)Cl |
Computed by PubChem (NCBI)