Products 587886-25-7

CAS 587886-25-7 is the registry number for 4-Bromo-7-fluoro-2-(trifluoromethyl)-8-quinolinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-bromo-7-fluoro-2-(trifluoromethyl)quinoline-8-carboxylic acid (CAS 587886-25-7) is a chemical compound with the molecular formula C11H4BrF4NO2 and a molecular weight of 338.05 g/mol. IUPAC name: 4-bromo-7-fluoro-2-(trifluoromethyl)quinoline-8-carboxylic acid. InChIKey: SWEOMCNBWSJBMU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H4BrF4NO2
Molecular weight338.05 g/mol
IUPAC name4-bromo-7-fluoro-2-(trifluoromethyl)quinoline-8-carboxylic acid
InChIKeySWEOMCNBWSJBMU-UHFFFAOYSA-N
SMILESC1=CC(=C(C2=C1C(=CC(=N2)C(F)(F)F)Br)C(=O)O)F

Computed by PubChem (NCBI)