CAS 58791-78-9 is the registry number for 5-Amino-1-(3,4-dichlorophenyl)-1h-pyrazole-4-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-amino-1-(3,4-dichlorophenyl)pyrazole-4-carbonitrile (CAS 58791-78-9) is a chemical compound with the molecular formula C10H6Cl2N4 and a molecular weight of 253.08 g/mol. IUPAC name: 5-amino-1-(3,4-dichlorophenyl)pyrazole-4-carbonitrile. InChIKey: LIBPJAAKKFAEAT-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N4 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | 5-amino-1-(3,4-dichlorophenyl)pyrazole-4-carbonitrile |
| InChIKey | LIBPJAAKKFAEAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=C(C=N2)C#N)N)Cl)Cl |
Computed by PubChem (NCBI)