CAS 58793-47-8 is the registry number for 1-Ethyl-5-nitro-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-ethyl-5-nitropyrazole (CAS 58793-47-8) is a chemical compound with the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. IUPAC name: 1-ethyl-5-nitropyrazole. InChIKey: GOYNSKFWMUFADH-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O2 |
|---|---|
| Molecular weight | 141.13 g/mol |
| IUPAC name | 1-ethyl-5-nitropyrazole |
| InChIKey | GOYNSKFWMUFADH-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)