CAS 58803-92-2 is the registry number for N,N-Diethyl-3,4,5-trimethyl-1H-pyrrole-2-carboxamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N,N-diethyl-3,4,5-trimethyl-1H-pyrrole-2-carboxamide (CAS 58803-92-2) is a chemical compound with the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. IUPAC name: N,N-diethyl-3,4,5-trimethyl-1H-pyrrole-2-carboxamide. InChIKey: BJFUEJMWVBADGW-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O |
|---|---|
| Molecular weight | 208.30 g/mol |
| IUPAC name | N,N-diethyl-3,4,5-trimethyl-1H-pyrrole-2-carboxamide |
| InChIKey | BJFUEJMWVBADGW-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C(=C(N1)C)C)C |
Computed by PubChem (NCBI)