CAS 58842-20-9 appears in our catalog under these names: Nithiazine, Nithiazine, >95% (HPLC), 2-(Nitromethylidene)-1,3-thiazinane, 2-(Nitromethylidene)-1,3-thiazinane, min. 95 %, 5 mg, 2-(Nitromethylidene)-1,3-thiazinane, min. 95 %, 10 mg. Offered by: Chemat Brand, TRC, Biosynth, Roth. Available pack sizes: on request, 25mg, 50mg, 5mg, 10mg, 100mg.
(2E)-2-(nitromethylidene)-1,3-thiazinane (CAS 58842-20-9) is a chemical compound with the molecular formula C5H8N2O2S and a molecular weight of 160.20 g/mol. IUPAC name: (2E)-2-(nitromethylidene)-1,3-thiazinane. InChIKey: LZTIMERBDGGAJD-SNAWJCMRSA-N.
| Molecular formula | C5H8N2O2S |
|---|---|
| Molecular weight | 160.20 g/mol |
| IUPAC name | (2E)-2-(nitromethylidene)-1,3-thiazinane |
| InChIKey | LZTIMERBDGGAJD-SNAWJCMRSA-N |
| SMILES | C1CN/C(=C\[N+](=O)[O-])/SC1 |
Computed by PubChem (NCBI)