CAS 588668-97-7 appears in our catalog under these names: 1,1,2,2,3,3-Hexafluoropropane-1,3-disulfonimide potassium salt, 95%, Potassium 1,1,2,2,3,3-Hexafluoropropane-1,3-disulfonimide, 1,1,2,2,3,3-Hexafluoropropane-1,3-disulfonimide potassium salt, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
Potassium 4,4,5,5,6,6-hexafluoro-1lambda6,3lambda6-dithia-2-azanidacyclohexane 1,1,3,3-tetraoxide (CAS 588668-97-7) is a chemical compound with the molecular formula C3F6KNO4S2 and a molecular weight of 331.3 g/mol. IUPAC name: potassium 4,4,5,5,6,6-hexafluoro-1lambda6,3lambda6-dithia-2-azanidacyclohexane 1,1,3,3-tetraoxide. InChIKey: XHXQVKHBZXYEKL-UHFFFAOYSA-N.
| Molecular formula | C3F6KNO4S2 |
|---|---|
| Molecular weight | 331.3 g/mol |
| IUPAC name | potassium 4,4,5,5,6,6-hexafluoro-1lambda6,3lambda6-dithia-2-azanidacyclohexane 1,1,3,3-tetraoxide |
| InChIKey | XHXQVKHBZXYEKL-UHFFFAOYSA-N |
| SMILES | C1(C(S(=O)(=O)[N-]S(=O)(=O)C1(F)F)(F)F)(F)F.[K+] |
Computed by PubChem (NCBI)