CAS 588674-64-0 appears in our catalog under these names: CCR6 antagonist 1/ 99.89% (existing batch purity), CCR6 antagonist 1, CCR6 antagonist 1 98%, CCR6 antagonist 1, 99.30%, 3-Methyl-N-[4-(trifluoromethyl)phenyl]-2-benzofurancarboxamide, 98%, 98%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM * 1mlindmso, 250mg.
3-methyl-N-[4-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide (CAS 588674-64-0) is a chemical compound with the molecular formula C17H12F3NO2 and a molecular weight of 319.28 g/mol. IUPAC name: 3-methyl-N-[4-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide. InChIKey: VHAWUBMHTMNOJC-UHFFFAOYSA-N.
| Molecular formula | C17H12F3NO2 |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | 3-methyl-N-[4-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide |
| InChIKey | VHAWUBMHTMNOJC-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=CC=CC=C12)C(=O)NC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)