Products 588681-44-1

CAS 588681-44-1 is the registry number for 6-Fluoro-2-(pyridin-2-yl)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

6-fluoro-2-pyridin-2-ylquinoline-4-carboxylic acid (CAS 588681-44-1) is a chemical compound with the molecular formula C15H9FN2O2 and a molecular weight of 268.24 g/mol. IUPAC name: 6-fluoro-2-pyridin-2-ylquinoline-4-carboxylic acid. InChIKey: CCZYDBUGWRSEGG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H9FN2O2
Molecular weight268.24 g/mol
IUPAC name6-fluoro-2-pyridin-2-ylquinoline-4-carboxylic acid
InChIKeyCCZYDBUGWRSEGG-UHFFFAOYSA-N
SMILESC1=CC=NC(=C1)C2=NC3=C(C=C(C=C3)F)C(=C2)C(=O)O

Computed by PubChem (NCBI)