CAS 58871-09-3 is the registry number for 6-O-(tert-Butyldimethylsilyl)-D-glucal. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol (CAS 58871-09-3) is a chemical compound with the molecular formula C12H24O4Si and a molecular weight of 260.40 g/mol. IUPAC name: (2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol. InChIKey: HYSBQWOHQIVUQQ-MXWKQRLJSA-N.
| Molecular formula | C12H24O4Si |
|---|---|
| Molecular weight | 260.40 g/mol |
| IUPAC name | (2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol |
| InChIKey | HYSBQWOHQIVUQQ-MXWKQRLJSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H]([C@@H](C=CO1)O)O |
Computed by PubChem (NCBI)