CAS 58878-84-5 is the registry number for 5-Bromo-1-(piperidin-4-yl)-1h-benzo[d]imidazol-2(3h)-one hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-bromo-3-piperidin-4-yl-1H-benzimidazol-2-one;hydrochloride (CAS 58878-84-5) is a chemical compound with the molecular formula C12H15BrClN3O and a molecular weight of 332.62 g/mol. IUPAC name: 6-bromo-3-piperidin-4-yl-1H-benzimidazol-2-one;hydrochloride. InChIKey: RYETYOFPXYOAIX-UHFFFAOYSA-N.
| Molecular formula | C12H15BrClN3O |
|---|---|
| Molecular weight | 332.62 g/mol |
| IUPAC name | 6-bromo-3-piperidin-4-yl-1H-benzimidazol-2-one;hydrochloride |
| InChIKey | RYETYOFPXYOAIX-UHFFFAOYSA-N |
| SMILES | C1CNCCC1N2C3=C(C=C(C=C3)Br)NC2=O.Cl |
Computed by PubChem (NCBI)