CAS 58878-95-8 is the registry number for rel-(3R,4S)-1-Benzyl-4-methylpiperidin-3-ol, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(3R,4S)-1-benzyl-4-methylpiperidin-3-ol (CAS 58878-95-8) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-methylpiperidin-3-ol. InChIKey: QRGQXVUZVXXWAG-AAEUAGOBSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-methylpiperidin-3-ol |
| InChIKey | QRGQXVUZVXXWAG-AAEUAGOBSA-N |
| SMILES | C[C@H]1CCN(C[C@@H]1O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)