CAS 58897-67-9 appears in our catalog under these names: 6-(4-Fluorophenyl)pyridazin-3(2h)-one, 95%, 6-(4-Fluorophenyl)pyridazin-3(2H)-one 95%, 6-(4-Fluorophenyl)pyridazin-3(2H)-one, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-(4-fluorophenyl)-1H-pyridazin-6-one (CAS 58897-67-9) is a chemical compound with the molecular formula C10H7FN2O and a molecular weight of 190.17 g/mol. IUPAC name: 3-(4-fluorophenyl)-1H-pyridazin-6-one. InChIKey: SWHTYHMWPIYECQ-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1H-pyridazin-6-one |
| InChIKey | SWHTYHMWPIYECQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)C=C2)F |
Computed by PubChem (NCBI)